C16H25N3 — CID 110967064
1-tert-butyl-2-methyl-3-[(1-phenylcyclopropyl)methyl]guanidine (PubChem CID 110967064) has the molecular formula C16H25N3 and a molecular weight of 259.40 g/mol. Its IUPAC name is 1-tert-butyl-2-methyl-3-[(1-phenylcyclopropyl)methyl]guanidine.
| Compound Name | 1-tert-butyl-2-methyl-3-[(1-phenylcyclopropyl)methyl]guanidine |
|---|---|
| PubChem CID | 110967064 |
| Molecular Formula | C16H25N3 |
| Molecular Weight | 259.40 g/mol |
| Exact Mass | 259.20 |
| IUPAC Name | 1-tert-butyl-2-methyl-3-[(1-phenylcyclopropyl)methyl]guanidine |
| SMILES | C/N=C(/NCC1(c2ccccc2)CC1)NC(C)(C)C |
| InChI | InChI=1S/C16H25N3/c1-15(2,3)19-14(17-4)18-12-16(10-11-16)13-8-6-5-7-9-13/h5-9H,10-12H2,1-4H3,(H2,17,18,19) |
| InChIKey | UGWMVKXGXRDVJV-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.40 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|