C21H35N3O2S — CID 111573533
1-(2-tert-butylsulfonylethyl)-3-ethyl-2-[(1-phenylcyclopentyl)methyl]guanidine (PubChem CID 111573533) has the molecular formula C21H35N3O2S and a molecular weight of 393.60 g/mol. Its IUPAC name is 1-(2-tert-butylsulfonylethyl)-3-ethyl-2-[(1-phenylcyclopentyl)methyl]guanidine.
| Compound Name | 1-(2-tert-butylsulfonylethyl)-3-ethyl-2-[(1-phenylcyclopentyl)methyl]guanidine |
|---|---|
| PubChem CID | 111573533 |
| Molecular Formula | C21H35N3O2S |
| Molecular Weight | 393.60 g/mol |
| Exact Mass | 393.24 |
| IUPAC Name | 1-(2-tert-butylsulfonylethyl)-3-ethyl-2-[(1-phenylcyclopentyl)methyl]guanidine |
| SMILES | CCN/C(=N\CC1(c2ccccc2)CCCC1)NCCS(=O)(=O)C(C)(C)C |
| InChI | InChI=1S/C21H35N3O2S/c1-5-22-19(23-15-16-27(25,26)20(2,3)4)24-17-21(13-9-10-14-21)18-11-7-6-8-12-18/h6-8,11-12H,5,9-10,13-17H2,1-4H3,(H2,22,23,24) |
| InChIKey | LQROXKUAJNXEGQ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.60 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|