C19H32IN3O4S — CID 109492066
1-[(1,1-dioxothiolan-3-yl)methyl]-3-ethyl-2-[2-hydroxy-2-(3-propan-2-yloxyphenyl)ethyl]guanidine;hydroiodide (PubChem CID 109492066) has the molecular formula C19H32IN3O4S and a molecular weight of 525.45 g/mol. Its IUPAC name is 1-[(1,1-dioxothiolan-3-yl)methyl]-3-ethyl-2-[2-hydroxy-2-(3-propan-2-yloxyphenyl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-[(1,1-dioxothiolan-3-yl)methyl]-3-ethyl-2-[2-hydroxy-2-(3-propan-2-yloxyphenyl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109492066 |
| Molecular Formula | C19H32IN3O4S |
| Molecular Weight | 525.45 g/mol |
| Exact Mass | 525.12 |
| IUPAC Name | 1-[(1,1-dioxothiolan-3-yl)methyl]-3-ethyl-2-[2-hydroxy-2-(3-propan-2-yloxyphenyl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(O)c1cccc(OC(C)C)c1)NCC1CCS(=O)(=O)C1.I |
| InChI | InChI=1S/C19H31N3O4S.HI/c1-4-20-19(21-11-15-8-9-27(24,25)13-15)22-12-18(23)16-6-5-7-17(10-16)26-14(2)3;/h5-7,10,14-15,18,23H,4,8-9,11-13H2,1-3H3,(H2,20,21,22);1H |
| InChIKey | YZWVOBXFMZKNPP-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.45 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|