C24H43IN4O2 — CID 109491833
1-ethyl-2-[2-hydroxy-2-(3-propan-2-yloxyphenyl)ethyl]-3-[[1-(2-methylpropyl)piperidin-3-yl]methyl]guanidine;hydroiodide (PubChem CID 109491833) has the molecular formula C24H43IN4O2 and a molecular weight of 546.54 g/mol. Its IUPAC name is 1-ethyl-2-[2-hydroxy-2-(3-propan-2-yloxyphenyl)ethyl]-3-[[1-(2-methylpropyl)piperidin-3-yl]methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[2-hydroxy-2-(3-propan-2-yloxyphenyl)ethyl]-3-[[1-(2-methylpropyl)piperidin-3-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 109491833 |
| Molecular Formula | C24H43IN4O2 |
| Molecular Weight | 546.54 g/mol |
| Exact Mass | 546.24 |
| IUPAC Name | 1-ethyl-2-[2-hydroxy-2-(3-propan-2-yloxyphenyl)ethyl]-3-[[1-(2-methylpropyl)piperidin-3-yl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(O)c1cccc(OC(C)C)c1)NCC1CCCN(CC(C)C)C1.I |
| InChI | InChI=1S/C24H42N4O2.HI/c1-6-25-24(26-14-20-9-8-12-28(17-20)16-18(2)3)27-15-23(29)21-10-7-11-22(13-21)30-19(4)5;/h7,10-11,13,18-20,23,29H,6,8-9,12,14-17H2,1-5H3,(H2,25,26,27);1H |
| InChIKey | KYUWDISHGRVNDH-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 69.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.54 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|