C15H27IN4O3S — CID 111584595
1-[(1,1-dioxothiolan-3-yl)methyl]-3-ethyl-2-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]guanidine;hydroiodide (PubChem CID 111584595) has the molecular formula C15H27IN4O3S and a molecular weight of 470.38 g/mol. Its IUPAC name is 1-[(1,1-dioxothiolan-3-yl)methyl]-3-ethyl-2-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[(1,1-dioxothiolan-3-yl)methyl]-3-ethyl-2-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111584595 |
| Molecular Formula | C15H27IN4O3S |
| Molecular Weight | 470.38 g/mol |
| Exact Mass | 470.08 |
| IUPAC Name | 1-[(1,1-dioxothiolan-3-yl)methyl]-3-ethyl-2-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc(C(C)C)no1)NCC1CCS(=O)(=O)C1.I |
| InChI | InChI=1S/C15H26N4O3S.HI/c1-4-16-15(17-8-12-5-6-23(20,21)10-12)18-9-13-7-14(11(2)3)19-22-13;/h7,11-12H,4-6,8-10H2,1-3H3,(H2,16,17,18);1H |
| InChIKey | JFNJMCAEULAZGG-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 96.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.38 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|