C21H38IN5O3 — CID 111586778
tert-butyl 2-[[[N-ethyl-N'-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]carbamimidoyl]amino]methyl]piperidine-1-carboxylate;hydroiodide (PubChem CID 111586778) has the molecular formula C21H38IN5O3 and a molecular weight of 535.47 g/mol. Its IUPAC name is tert-butyl 2-[[[N-ethyl-N'-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]carbamimidoyl]amino]methyl]piperidine-1-carboxylate;hydroiodide.
| Compound Name | tert-butyl 2-[[[N-ethyl-N'-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]carbamimidoyl]amino]methyl]piperidine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111586778 |
| Molecular Formula | C21H38IN5O3 |
| Molecular Weight | 535.47 g/mol |
| Exact Mass | 535.20 |
| IUPAC Name | tert-butyl 2-[[[N-ethyl-N'-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]carbamimidoyl]amino]methyl]piperidine-1-carboxylate;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc(C(C)C)no1)NCC1CCCCN1C(=O)OC(C)(C)C.I |
| InChI | InChI=1S/C21H37N5O3.HI/c1-7-22-19(24-14-17-12-18(15(2)3)25-29-17)23-13-16-10-8-9-11-26(16)20(27)28-21(4,5)6;/h12,15-16H,7-11,13-14H2,1-6H3,(H2,22,23,24);1H |
| InChIKey | IPGWRKPLVYJDEI-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 91.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.47 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|