C22H33N5O3S — CID 111586397
1-[[1-(benzenesulfonyl)piperidin-4-yl]methyl]-3-ethyl-2-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]guanidine (PubChem CID 111586397) has the molecular formula C22H33N5O3S and a molecular weight of 447.61 g/mol. Its IUPAC name is 1-[[1-(benzenesulfonyl)piperidin-4-yl]methyl]-3-ethyl-2-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]guanidine.
| Compound Name | 1-[[1-(benzenesulfonyl)piperidin-4-yl]methyl]-3-ethyl-2-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111586397 |
| Molecular Formula | C22H33N5O3S |
| Molecular Weight | 447.61 g/mol |
| Exact Mass | 447.23 |
| IUPAC Name | 1-[[1-(benzenesulfonyl)piperidin-4-yl]methyl]-3-ethyl-2-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1cc(C(C)C)no1)NCC1CCN(S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C22H33N5O3S/c1-4-23-22(25-16-19-14-21(17(2)3)26-30-19)24-15-18-10-12-27(13-11-18)31(28,29)20-8-6-5-7-9-20/h5-9,14,17-18H,4,10-13,15-16H2,1-3H3,(H2,23,24,25) |
| InChIKey | IMADRKTXLAYTOF-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 99.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.61 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|