C24H39IN6O — CID 111584784
1-ethyl-3-[3-(4-methyl-2-phenylpiperazin-1-yl)propyl]-2-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]guanidine;hydroiodide (PubChem CID 111584784) has the molecular formula C24H39IN6O and a molecular weight of 554.52 g/mol. Its IUPAC name is 1-ethyl-3-[3-(4-methyl-2-phenylpiperazin-1-yl)propyl]-2-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[3-(4-methyl-2-phenylpiperazin-1-yl)propyl]-2-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111584784 |
| Molecular Formula | C24H39IN6O |
| Molecular Weight | 554.52 g/mol |
| Exact Mass | 554.22 |
| IUPAC Name | 1-ethyl-3-[3-(4-methyl-2-phenylpiperazin-1-yl)propyl]-2-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc(C(C)C)no1)NCCCN1CCN(C)CC1c1ccccc1.I |
| InChI | InChI=1S/C24H38N6O.HI/c1-5-25-24(27-17-21-16-22(19(2)3)28-31-21)26-12-9-13-30-15-14-29(4)18-23(30)20-10-7-6-8-11-20;/h6-8,10-11,16,19,23H,5,9,12-15,17-18H2,1-4H3,(H2,25,26,27);1H |
| InChIKey | JFTNIQKMUHHOHK-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 68.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.52 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|