C25H41IN6O — CID 111587062
1-[4-(4-benzylpiperazin-1-yl)butyl]-3-ethyl-2-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]guanidine;hydroiodide (PubChem CID 111587062) has the molecular formula C25H41IN6O and a molecular weight of 568.55 g/mol. Its IUPAC name is 1-[4-(4-benzylpiperazin-1-yl)butyl]-3-ethyl-2-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[4-(4-benzylpiperazin-1-yl)butyl]-3-ethyl-2-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111587062 |
| Molecular Formula | C25H41IN6O |
| Molecular Weight | 568.55 g/mol |
| Exact Mass | 568.24 |
| IUPAC Name | 1-[4-(4-benzylpiperazin-1-yl)butyl]-3-ethyl-2-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc(C(C)C)no1)NCCCCN1CCN(Cc2ccccc2)CC1.I |
| InChI | InChI=1S/C25H40N6O.HI/c1-4-26-25(28-19-23-18-24(21(2)3)29-32-23)27-12-8-9-13-30-14-16-31(17-15-30)20-22-10-6-5-7-11-22;/h5-7,10-11,18,21H,4,8-9,12-17,19-20H2,1-3H3,(H2,26,27,28);1H |
| InChIKey | ZXLWIZVAXRHAAW-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 68.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.55 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|