C22H41IN6O3 — CID 111587080
tert-butyl 4-[3-[[N-ethyl-N'-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]carbamimidoyl]amino]propyl]piperazine-1-carboxylate;hydroiodide (PubChem CID 111587080) has the molecular formula C22H41IN6O3 and a molecular weight of 564.51 g/mol. Its IUPAC name is tert-butyl 4-[3-[[N-ethyl-N'-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]carbamimidoyl]amino]propyl]piperazine-1-carboxylate;hydroiodide.
| Compound Name | tert-butyl 4-[3-[[N-ethyl-N'-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]carbamimidoyl]amino]propyl]piperazine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111587080 |
| Molecular Formula | C22H41IN6O3 |
| Molecular Weight | 564.51 g/mol |
| Exact Mass | 564.23 |
| IUPAC Name | tert-butyl 4-[3-[[N-ethyl-N'-[(3-propan-2-yl-1,2-oxazol-5-yl)methyl]carbamimidoyl]amino]propyl]piperazine-1-carboxylate;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc(C(C)C)no1)NCCCN1CCN(C(=O)OC(C)(C)C)CC1.I |
| InChI | InChI=1S/C22H40N6O3.HI/c1-7-23-20(25-16-18-15-19(17(2)3)26-31-18)24-9-8-10-27-11-13-28(14-12-27)21(29)30-22(4,5)6;/h15,17H,7-14,16H2,1-6H3,(H2,23,24,25);1H |
| InChIKey | YHUIMQNDRFJSMF-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 95.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.51 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|