C27H50N4O12 — CID 140529248
tert-butyl N-[(2R,4R,5S)-6-(aminomethyl)-2-[(1R,2R,4R)-2,3-dihydroxy-4,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]oxy-4,5-dihydroxyoxan-3-yl]carbamate (PubChem CID 140529248) has the molecular formula C27H50N4O12 and a molecular weight of 622.71 g/mol. Its IUPAC name is tert-butyl N-[(2R,4R,5S)-6-(aminomethyl)-2-[(1R,2R,4R)-2,3-dihydroxy-4,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]oxy-4,5-dihydroxyoxan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(2R,4R,5S)-6-(aminomethyl)-2-[(1R,2R,4R)-2,3-dihydroxy-4,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]oxy-4,5-dihydroxyoxan-3-yl]carbamate |
|---|---|
| PubChem CID | 140529248 |
| Molecular Formula | C27H50N4O12 |
| Molecular Weight | 622.71 g/mol |
| Exact Mass | 622.34 |
| IUPAC Name | tert-butyl N-[(2R,4R,5S)-6-(aminomethyl)-2-[(1R,2R,4R)-2,3-dihydroxy-4,6-bis[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]oxy-4,5-dihydroxyoxan-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1[C@@H](O[C@@H]2C(NC(=O)OC(C)(C)C)C[C@@H](NC(=O)OC(C)(C)C)C(O)[C@H]2O)OC(CN)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C27H50N4O12/c1-25(2,3)41-22(36)29-12-10-13(30-23(37)42-26(4,5)6)20(19(35)16(12)32)40-21-15(31-24(38)43-27(7,8)9)18(34)17(33)14(11-28)39-21/h12-21,32-35H,10-11,28H2,1-9H3,(H,29,36)(H,30,37)(H,31,38)/t12-,13?,14?,15?,16?,17-,18-,19-,20-,21-/m1/s1 |
| InChIKey | AFBPCZGMTUJBNY-GICAHWPKSA-N |
| XLogP | -0.42 |
| TPSA | 240.39 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.71 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|