C16H30N2O8 — CID 101404623
[(2S,3R,4R,5S,6R)-6-(aminomethyl)-4,5-dihydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]oxan-2-yl] tert-butyl carbonate (PubChem CID 101404623) has the molecular formula C16H30N2O8 and a molecular weight of 378.42 g/mol. Its IUPAC name is [(2S,3R,4R,5S,6R)-6-(aminomethyl)-4,5-dihydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]oxan-2-yl] tert-butyl carbonate.
| Compound Name | [(2S,3R,4R,5S,6R)-6-(aminomethyl)-4,5-dihydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]oxan-2-yl] tert-butyl carbonate |
|---|---|
| PubChem CID | 101404623 |
| Molecular Formula | C16H30N2O8 |
| Molecular Weight | 378.42 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | [(2S,3R,4R,5S,6R)-6-(aminomethyl)-4,5-dihydroxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]oxan-2-yl] tert-butyl carbonate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1[C@H](OC(=O)OC(C)(C)C)O[C@H](CN)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H30N2O8/c1-15(2,3)25-13(21)18-9-11(20)10(19)8(7-17)23-12(9)24-14(22)26-16(4,5)6/h8-12,19-20H,7,17H2,1-6H3,(H,18,21)/t8-,9-,10-,11-,12+/m1/s1 |
| InChIKey | PVKOOHHBXASVGY-OOCWMUITSA-N |
| XLogP | 0.24 |
| TPSA | 149.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.42 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |