C19H27N3O6 — CID 85497368
methyl 5-[(2,3,4-trimethoxybenzoyl)amino]-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-3-carboxylate (PubChem CID 85497368) has the molecular formula C19H27N3O6 and a molecular weight of 393.44 g/mol. Its IUPAC name is methyl 5-[(2,3,4-trimethoxybenzoyl)amino]-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-3-carboxylate.
| Compound Name | methyl 5-[(2,3,4-trimethoxybenzoyl)amino]-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-3-carboxylate |
|---|---|
| PubChem CID | 85497368 |
| Molecular Formula | C19H27N3O6 |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | methyl 5-[(2,3,4-trimethoxybenzoyl)amino]-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-3-carboxylate |
| SMILES | COC(=O)C1NNC2CCC(NC(=O)c3ccc(OC)c(OC)c3OC)CC21 |
| InChI | InChI=1S/C19H27N3O6/c1-25-14-8-6-11(16(26-2)17(14)27-3)18(23)20-10-5-7-13-12(9-10)15(22-21-13)19(24)28-4/h6,8,10,12-13,15,21-22H,5,7,9H2,1-4H3,(H,20,23) |
| InChIKey | QHRPNZBRNZNQIM-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 107.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |