C17H21N3O5 — CID 74624349
methyl 5-(1,3-benzodioxole-5-carbonylamino)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-3-carboxylate (PubChem CID 74624349) has the molecular formula C17H21N3O5 and a molecular weight of 347.37 g/mol. Its IUPAC name is methyl 5-(1,3-benzodioxole-5-carbonylamino)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-3-carboxylate.
| Compound Name | methyl 5-(1,3-benzodioxole-5-carbonylamino)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-3-carboxylate |
|---|---|
| PubChem CID | 74624349 |
| Molecular Formula | C17H21N3O5 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | methyl 5-(1,3-benzodioxole-5-carbonylamino)-2,3,3a,4,5,6,7,7a-octahydro-1H-indazole-3-carboxylate |
| SMILES | COC(=O)C1NNC2CCC(NC(=O)c3ccc4c(c3)OCO4)CC21 |
| InChI | InChI=1S/C17H21N3O5/c1-23-17(22)15-11-7-10(3-4-12(11)19-20-15)18-16(21)9-2-5-13-14(6-9)25-8-24-13/h2,5-6,10-12,15,19-20H,3-4,7-8H2,1H3,(H,18,21) |
| InChIKey | SDSHOJZQPZCJAK-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 97.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |