C15H18Cl2N2O2 — CID 119457942
N-(8-azabicyclo[3.2.1]octan-3-yl)-4,5-dichloro-2-methoxybenzamide (PubChem CID 119457942) has the molecular formula C15H18Cl2N2O2 and a molecular weight of 329.23 g/mol. Its IUPAC name is N-(8-azabicyclo[3.2.1]octan-3-yl)-4,5-dichloro-2-methoxybenzamide.
| Compound Name | N-(8-azabicyclo[3.2.1]octan-3-yl)-4,5-dichloro-2-methoxybenzamide |
|---|---|
| PubChem CID | 119457942 |
| Molecular Formula | C15H18Cl2N2O2 |
| Molecular Weight | 329.23 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | N-(8-azabicyclo[3.2.1]octan-3-yl)-4,5-dichloro-2-methoxybenzamide |
| SMILES | COc1cc(Cl)c(Cl)cc1C(=O)NC1CC2CCC(C1)N2 |
| InChI | InChI=1S/C15H18Cl2N2O2/c1-21-14-7-13(17)12(16)6-11(14)15(20)19-10-4-8-2-3-9(5-10)18-8/h6-10,18H,2-5H2,1H3,(H,19,20) |
| InChIKey | URLABZQTTCOUHM-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.23 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |