C22H25ClN3O2+ — CID 9020805
N-(2-chlorophenyl)-2-[4-[(E)-3-(3-methylphenyl)prop-2-enoyl]piperazin-1-ium-1-yl]acetamide (PubChem CID 9020805) has the molecular formula C22H25ClN3O2+ and a molecular weight of 398.91 g/mol. Its IUPAC name is N-(2-chlorophenyl)-2-[4-[(E)-3-(3-methylphenyl)prop-2-enoyl]piperazin-1-ium-1-yl]acetamide.
| Compound Name | N-(2-chlorophenyl)-2-[4-[(E)-3-(3-methylphenyl)prop-2-enoyl]piperazin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 9020805 |
| Molecular Formula | C22H25ClN3O2+ |
| Molecular Weight | 398.91 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | N-(2-chlorophenyl)-2-[4-[(E)-3-(3-methylphenyl)prop-2-enoyl]piperazin-1-ium-1-yl]acetamide |
| SMILES | Cc1cccc(/C=C/C(=O)N2CC[NH+](CC(=O)Nc3ccccc3Cl)CC2)c1 |
| InChI | InChI=1S/C22H24ClN3O2/c1-17-5-4-6-18(15-17)9-10-22(28)26-13-11-25(12-14-26)16-21(27)24-20-8-3-2-7-19(20)23/h2-10,15H,11-14,16H2,1H3,(H,24,27)/p+1/b10-9+ |
| InChIKey | RRDIMCGQWGLFCT-MDZDMXLPSA-O |
| XLogP | 2.03 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.91 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|