C25H34N3O3+ — CID 9022310
N-(2-ethylphenyl)-2-[4-[4-(4-methylphenoxy)butanoyl]piperazin-1-ium-1-yl]acetamide (PubChem CID 9022310) has the molecular formula C25H34N3O3+ and a molecular weight of 424.57 g/mol. Its IUPAC name is N-(2-ethylphenyl)-2-[4-[4-(4-methylphenoxy)butanoyl]piperazin-1-ium-1-yl]acetamide.
| Compound Name | N-(2-ethylphenyl)-2-[4-[4-(4-methylphenoxy)butanoyl]piperazin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 9022310 |
| Molecular Formula | C25H34N3O3+ |
| Molecular Weight | 424.57 g/mol |
| Exact Mass | 424.26 |
| IUPAC Name | N-(2-ethylphenyl)-2-[4-[4-(4-methylphenoxy)butanoyl]piperazin-1-ium-1-yl]acetamide |
| SMILES | CCc1ccccc1NC(=O)C[NH+]1CCN(C(=O)CCCOc2ccc(C)cc2)CC1 |
| InChI | InChI=1S/C25H33N3O3/c1-3-21-7-4-5-8-23(21)26-24(29)19-27-14-16-28(17-15-27)25(30)9-6-18-31-22-12-10-20(2)11-13-22/h4-5,7-8,10-13H,3,6,9,14-19H2,1-2H3,(H,26,29)/p+1 |
| InChIKey | ZLAKQCTYYDHVCR-UHFFFAOYSA-O |
| XLogP | 2.08 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.57 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|