C19H21N2O3S+ — CID 9180661
(E)-3-(1,3-benzodioxol-5-yl)-1-[4-(thiophen-3-ylmethyl)piperazin-4-ium-1-yl]prop-2-en-1-one (PubChem CID 9180661) has the molecular formula C19H21N2O3S+ and a molecular weight of 357.46 g/mol. Its IUPAC name is (E)-3-(1,3-benzodioxol-5-yl)-1-[4-(thiophen-3-ylmethyl)piperazin-4-ium-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(1,3-benzodioxol-5-yl)-1-[4-(thiophen-3-ylmethyl)piperazin-4-ium-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 9180661 |
| Molecular Formula | C19H21N2O3S+ |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | (E)-3-(1,3-benzodioxol-5-yl)-1-[4-(thiophen-3-ylmethyl)piperazin-4-ium-1-yl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc2c(c1)OCO2)N1CC[NH+](Cc2ccsc2)CC1 |
| InChI | InChI=1S/C19H20N2O3S/c22-19(4-2-15-1-3-17-18(11-15)24-14-23-17)21-8-6-20(7-9-21)12-16-5-10-25-13-16/h1-5,10-11,13H,6-9,12,14H2/p+1/b4-2+ |
| InChIKey | ONNNEWBOKULAML-DUXPYHPUSA-O |
| XLogP | 1.42 |
| TPSA | 43.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|