C21H25FN3O2+ — CID 9223295
2-(4-benzoylpiperazin-1-ium-1-yl)-N-[(3-fluorophenyl)methyl]-N-methylacetamide (PubChem CID 9223295) has the molecular formula C21H25FN3O2+ and a molecular weight of 370.45 g/mol. Its IUPAC name is 2-(4-benzoylpiperazin-1-ium-1-yl)-N-[(3-fluorophenyl)methyl]-N-methylacetamide.
| Compound Name | 2-(4-benzoylpiperazin-1-ium-1-yl)-N-[(3-fluorophenyl)methyl]-N-methylacetamide |
|---|---|
| PubChem CID | 9223295 |
| Molecular Formula | C21H25FN3O2+ |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | 2-(4-benzoylpiperazin-1-ium-1-yl)-N-[(3-fluorophenyl)methyl]-N-methylacetamide |
| SMILES | CN(Cc1cccc(F)c1)C(=O)C[NH+]1CCN(C(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C21H24FN3O2/c1-23(15-17-6-5-9-19(22)14-17)20(26)16-24-10-12-25(13-11-24)21(27)18-7-3-2-4-8-18/h2-9,14H,10-13,15-16H2,1H3/p+1 |
| InChIKey | QZMIWFRAALYLMI-UHFFFAOYSA-O |
| XLogP | 0.82 |
| TPSA | 45.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |