C21H26N3O3+ — CID 9021756
N,N-dimethyl-2-[4-(4-phenoxybenzoyl)piperazin-1-ium-1-yl]acetamide (PubChem CID 9021756) has the molecular formula C21H26N3O3+ and a molecular weight of 368.46 g/mol. Its IUPAC name is N,N-dimethyl-2-[4-(4-phenoxybenzoyl)piperazin-1-ium-1-yl]acetamide.
| Compound Name | N,N-dimethyl-2-[4-(4-phenoxybenzoyl)piperazin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 9021756 |
| Molecular Formula | C21H26N3O3+ |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | N,N-dimethyl-2-[4-(4-phenoxybenzoyl)piperazin-1-ium-1-yl]acetamide |
| SMILES | CN(C)C(=O)C[NH+]1CCN(C(=O)c2ccc(Oc3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C21H25N3O3/c1-22(2)20(25)16-23-12-14-24(15-13-23)21(26)17-8-10-19(11-9-17)27-18-6-4-3-5-7-18/h3-11H,12-16H2,1-2H3/p+1 |
| InChIKey | GGTGMXSLONEEMK-UHFFFAOYSA-O |
| XLogP | 0.91 |
| TPSA | 54.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |