C18H29N4O4S+ — CID 8692700
(2R)-2-[[2-[4-(benzenesulfonyl)piperazin-1-ium-1-yl]acetyl]amino]-N-propylpropanamide (PubChem CID 8692700) has the molecular formula C18H29N4O4S+ and a molecular weight of 397.52 g/mol. Its IUPAC name is (2R)-2-[[2-[4-(benzenesulfonyl)piperazin-1-ium-1-yl]acetyl]amino]-N-propylpropanamide.
| Compound Name | (2R)-2-[[2-[4-(benzenesulfonyl)piperazin-1-ium-1-yl]acetyl]amino]-N-propylpropanamide |
|---|---|
| PubChem CID | 8692700 |
| Molecular Formula | C18H29N4O4S+ |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | (2R)-2-[[2-[4-(benzenesulfonyl)piperazin-1-ium-1-yl]acetyl]amino]-N-propylpropanamide |
| SMILES | CCCNC(=O)[C@@H](C)NC(=O)C[NH+]1CCN(S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C18H28N4O4S/c1-3-9-19-18(24)15(2)20-17(23)14-21-10-12-22(13-11-21)27(25,26)16-7-5-4-6-8-16/h4-8,15H,3,9-14H2,1-2H3,(H,19,24)(H,20,23)/p+1/t15-/m1/s1 |
| InChIKey | NQLULSJTKIDUPN-OAHLLOKOSA-O |
| XLogP | -1.39 |
| TPSA | 100.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |