C18H23ClN3O4S+ — CID 8690901
2-[4-(3-chlorophenyl)sulfonylpiperazin-1-ium-1-yl]-N-[(1S)-1-(furan-2-yl)ethyl]acetamide (PubChem CID 8690901) has the molecular formula C18H23ClN3O4S+ and a molecular weight of 412.92 g/mol. Its IUPAC name is 2-[4-(3-chlorophenyl)sulfonylpiperazin-1-ium-1-yl]-N-[(1S)-1-(furan-2-yl)ethyl]acetamide.
| Compound Name | 2-[4-(3-chlorophenyl)sulfonylpiperazin-1-ium-1-yl]-N-[(1S)-1-(furan-2-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 8690901 |
| Molecular Formula | C18H23ClN3O4S+ |
| Molecular Weight | 412.92 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | 2-[4-(3-chlorophenyl)sulfonylpiperazin-1-ium-1-yl]-N-[(1S)-1-(furan-2-yl)ethyl]acetamide |
| SMILES | C[C@H](NC(=O)C[NH+]1CCN(S(=O)(=O)c2cccc(Cl)c2)CC1)c1ccco1 |
| InChI | InChI=1S/C18H22ClN3O4S/c1-14(17-6-3-11-26-17)20-18(23)13-21-7-9-22(10-8-21)27(24,25)16-5-2-4-15(19)12-16/h2-6,11-12,14H,7-10,13H2,1H3,(H,20,23)/p+1/t14-/m0/s1 |
| InChIKey | AGMLFYWMQPLINU-AWEZNQCLSA-O |
| XLogP | 0.70 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.92 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |