C17H26Cl2N3O3S+ — CID 8748312
2-[4-(3,4-dichlorophenyl)sulfonylpiperazin-1-ium-1-yl]-N-pentan-3-ylacetamide (PubChem CID 8748312) has the molecular formula C17H26Cl2N3O3S+ and a molecular weight of 423.39 g/mol. Its IUPAC name is 2-[4-(3,4-dichlorophenyl)sulfonylpiperazin-1-ium-1-yl]-N-pentan-3-ylacetamide.
| Compound Name | 2-[4-(3,4-dichlorophenyl)sulfonylpiperazin-1-ium-1-yl]-N-pentan-3-ylacetamide |
|---|---|
| PubChem CID | 8748312 |
| Molecular Formula | C17H26Cl2N3O3S+ |
| Molecular Weight | 423.39 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | 2-[4-(3,4-dichlorophenyl)sulfonylpiperazin-1-ium-1-yl]-N-pentan-3-ylacetamide |
| SMILES | CCC(CC)NC(=O)C[NH+]1CCN(S(=O)(=O)c2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C17H25Cl2N3O3S/c1-3-13(4-2)20-17(23)12-21-7-9-22(10-8-21)26(24,25)14-5-6-15(18)16(19)11-14/h5-6,11,13H,3-4,7-10,12H2,1-2H3,(H,20,23)/p+1 |
| InChIKey | IFMKASHQFKNBBW-UHFFFAOYSA-O |
| XLogP | 1.19 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.39 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |