C19H22ClN2O4S+ — CID 5056586
2-[4-(4-chlorophenyl)sulfonylpiperazin-1-ium-1-yl]-1-(4-methoxyphenyl)ethanone (PubChem CID 5056586) has the molecular formula C19H22ClN2O4S+ and a molecular weight of 409.92 g/mol. Its IUPAC name is 2-[4-(4-chlorophenyl)sulfonylpiperazin-1-ium-1-yl]-1-(4-methoxyphenyl)ethanone.
| Compound Name | 2-[4-(4-chlorophenyl)sulfonylpiperazin-1-ium-1-yl]-1-(4-methoxyphenyl)ethanone |
|---|---|
| PubChem CID | 5056586 |
| Molecular Formula | C19H22ClN2O4S+ |
| Molecular Weight | 409.92 g/mol |
| Exact Mass | 409.10 |
| IUPAC Name | 2-[4-(4-chlorophenyl)sulfonylpiperazin-1-ium-1-yl]-1-(4-methoxyphenyl)ethanone |
| SMILES | COc1ccc(C(=O)C[NH+]2CCN(S(=O)(=O)c3ccc(Cl)cc3)CC2)cc1 |
| InChI | InChI=1S/C19H21ClN2O4S/c1-26-17-6-2-15(3-7-17)19(23)14-21-10-12-22(13-11-21)27(24,25)18-8-4-16(20)5-9-18/h2-9H,10-14H2,1H3/p+1 |
| InChIKey | KMTKPIDXJVHCAF-UHFFFAOYSA-O |
| XLogP | 1.12 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.92 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |