C21H34N3O4S+ — CID 8687308
N-cyclohexyl-N-ethyl-2-[4-(4-methoxyphenyl)sulfonylpiperazin-1-ium-1-yl]acetamide (PubChem CID 8687308) has the molecular formula C21H34N3O4S+ and a molecular weight of 424.59 g/mol. Its IUPAC name is N-cyclohexyl-N-ethyl-2-[4-(4-methoxyphenyl)sulfonylpiperazin-1-ium-1-yl]acetamide.
| Compound Name | N-cyclohexyl-N-ethyl-2-[4-(4-methoxyphenyl)sulfonylpiperazin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 8687308 |
| Molecular Formula | C21H34N3O4S+ |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.23 |
| IUPAC Name | N-cyclohexyl-N-ethyl-2-[4-(4-methoxyphenyl)sulfonylpiperazin-1-ium-1-yl]acetamide |
| SMILES | CCN(C(=O)C[NH+]1CCN(S(=O)(=O)c2ccc(OC)cc2)CC1)C1CCCCC1 |
| InChI | InChI=1S/C21H33N3O4S/c1-3-24(18-7-5-4-6-8-18)21(25)17-22-13-15-23(16-14-22)29(26,27)20-11-9-19(28-2)10-12-20/h9-12,18H,3-8,13-17H2,1-2H3/p+1 |
| InChIKey | ULIMFLBKSGYOHK-UHFFFAOYSA-O |
| XLogP | 0.77 |
| TPSA | 71.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |