C19H29ClN3O3S+ — CID 8690599
2-[4-(3-chlorophenyl)sulfonylpiperazin-1-ium-1-yl]-N-cyclohexyl-N-methylacetamide (PubChem CID 8690599) has the molecular formula C19H29ClN3O3S+ and a molecular weight of 414.98 g/mol. Its IUPAC name is 2-[4-(3-chlorophenyl)sulfonylpiperazin-1-ium-1-yl]-N-cyclohexyl-N-methylacetamide.
| Compound Name | 2-[4-(3-chlorophenyl)sulfonylpiperazin-1-ium-1-yl]-N-cyclohexyl-N-methylacetamide |
|---|---|
| PubChem CID | 8690599 |
| Molecular Formula | C19H29ClN3O3S+ |
| Molecular Weight | 414.98 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | 2-[4-(3-chlorophenyl)sulfonylpiperazin-1-ium-1-yl]-N-cyclohexyl-N-methylacetamide |
| SMILES | CN(C(=O)C[NH+]1CCN(S(=O)(=O)c2cccc(Cl)c2)CC1)C1CCCCC1 |
| InChI | InChI=1S/C19H28ClN3O3S/c1-21(17-7-3-2-4-8-17)19(24)15-22-10-12-23(13-11-22)27(25,26)18-9-5-6-16(20)14-18/h5-6,9,14,17H,2-4,7-8,10-13,15H2,1H3/p+1 |
| InChIKey | ALWSNELPQSSGGC-UHFFFAOYSA-O |
| XLogP | 1.02 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.98 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |