C16H25ClN2O5S — CID 129008374
2-[ethyl-[1-(4-methoxyphenyl)sulfonylpiperidin-4-yl]amino]acetic acid;hydrochloride (PubChem CID 129008374) has the molecular formula C16H25ClN2O5S and a molecular weight of 392.91 g/mol. Its IUPAC name is 2-[ethyl-[1-(4-methoxyphenyl)sulfonylpiperidin-4-yl]amino]acetic acid;hydrochloride.
| Compound Name | 2-[ethyl-[1-(4-methoxyphenyl)sulfonylpiperidin-4-yl]amino]acetic acid;hydrochloride |
|---|---|
| PubChem CID | 129008374 |
| Molecular Formula | C16H25ClN2O5S |
| Molecular Weight | 392.91 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | 2-[ethyl-[1-(4-methoxyphenyl)sulfonylpiperidin-4-yl]amino]acetic acid;hydrochloride |
| SMILES | CCN(CC(=O)O)C1CCN(S(=O)(=O)c2ccc(OC)cc2)CC1.Cl |
| InChI | InChI=1S/C16H24N2O5S.ClH/c1-3-17(12-16(19)20)13-8-10-18(11-9-13)24(21,22)15-6-4-14(23-2)5-7-15;/h4-7,13H,3,8-12H2,1-2H3,(H,19,20);1H |
| InChIKey | ZMPQFTBKVFUCIU-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.91 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |