C16H23FN2O5S — CID 128997282
2-[ethyl-[1-(3-fluoro-4-methoxyphenyl)sulfonylpiperidin-4-yl]amino]acetic acid (PubChem CID 128997282) has the molecular formula C16H23FN2O5S and a molecular weight of 374.43 g/mol. Its IUPAC name is 2-[ethyl-[1-(3-fluoro-4-methoxyphenyl)sulfonylpiperidin-4-yl]amino]acetic acid.
| Compound Name | 2-[ethyl-[1-(3-fluoro-4-methoxyphenyl)sulfonylpiperidin-4-yl]amino]acetic acid |
|---|---|
| PubChem CID | 128997282 |
| Molecular Formula | C16H23FN2O5S |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | 2-[ethyl-[1-(3-fluoro-4-methoxyphenyl)sulfonylpiperidin-4-yl]amino]acetic acid |
| SMILES | CCN(CC(=O)O)C1CCN(S(=O)(=O)c2ccc(OC)c(F)c2)CC1 |
| InChI | InChI=1S/C16H23FN2O5S/c1-3-18(11-16(20)21)12-6-8-19(9-7-12)25(22,23)13-4-5-15(24-2)14(17)10-13/h4-5,10,12H,3,6-9,11H2,1-2H3,(H,20,21) |
| InChIKey | IPJXGIZXMCIPTD-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |