C17H28N2O4S2 — CID 129008381
2-[[1-(5-tert-butylthiophen-2-yl)sulfonylpiperidin-4-yl]-ethylamino]acetic acid (PubChem CID 129008381) has the molecular formula C17H28N2O4S2 and a molecular weight of 388.56 g/mol. Its IUPAC name is 2-[[1-(5-tert-butylthiophen-2-yl)sulfonylpiperidin-4-yl]-ethylamino]acetic acid.
| Compound Name | 2-[[1-(5-tert-butylthiophen-2-yl)sulfonylpiperidin-4-yl]-ethylamino]acetic acid |
|---|---|
| PubChem CID | 129008381 |
| Molecular Formula | C17H28N2O4S2 |
| Molecular Weight | 388.56 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 2-[[1-(5-tert-butylthiophen-2-yl)sulfonylpiperidin-4-yl]-ethylamino]acetic acid |
| SMILES | CCN(CC(=O)O)C1CCN(S(=O)(=O)c2ccc(C(C)(C)C)s2)CC1 |
| InChI | InChI=1S/C17H28N2O4S2/c1-5-18(12-15(20)21)13-8-10-19(11-9-13)25(22,23)16-7-6-14(24-16)17(2,3)4/h6-7,13H,5,8-12H2,1-4H3,(H,20,21) |
| InChIKey | OXEJHVUKNJYOIB-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.56 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |