C28H29FN2O3S — CID 20932807
3-[1-(3-fluorophenyl)sulfonylpiperidin-4-yl]-1-[(3-methoxyphenyl)methyl]-2-methylindole (PubChem CID 20932807) has the molecular formula C28H29FN2O3S and a molecular weight of 492.62 g/mol. Its IUPAC name is 3-[1-(3-fluorophenyl)sulfonylpiperidin-4-yl]-1-[(3-methoxyphenyl)methyl]-2-methylindole.
| Compound Name | 3-[1-(3-fluorophenyl)sulfonylpiperidin-4-yl]-1-[(3-methoxyphenyl)methyl]-2-methylindole |
|---|---|
| PubChem CID | 20932807 |
| Molecular Formula | C28H29FN2O3S |
| Molecular Weight | 492.62 g/mol |
| Exact Mass | 492.19 |
| IUPAC Name | 3-[1-(3-fluorophenyl)sulfonylpiperidin-4-yl]-1-[(3-methoxyphenyl)methyl]-2-methylindole |
| SMILES | COc1cccc(Cn2c(C)c(C3CCN(S(=O)(=O)c4cccc(F)c4)CC3)c3ccccc32)c1 |
| InChI | InChI=1S/C28H29FN2O3S/c1-20-28(22-13-15-30(16-14-22)35(32,33)25-10-6-8-23(29)18-25)26-11-3-4-12-27(26)31(20)19-21-7-5-9-24(17-21)34-2/h3-12,17-18,22H,13-16,19H2,1-2H3 |
| InChIKey | GTEZBTBYUKDCBT-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.62 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|