C28H28F2N2O3S — CID 20932816
3-[1-(2,4-difluorophenyl)sulfonylpiperidin-4-yl]-1-[(3-methoxyphenyl)methyl]-2-methylindole (PubChem CID 20932816) has the molecular formula C28H28F2N2O3S and a molecular weight of 510.61 g/mol. Its IUPAC name is 3-[1-(2,4-difluorophenyl)sulfonylpiperidin-4-yl]-1-[(3-methoxyphenyl)methyl]-2-methylindole.
| Compound Name | 3-[1-(2,4-difluorophenyl)sulfonylpiperidin-4-yl]-1-[(3-methoxyphenyl)methyl]-2-methylindole |
|---|---|
| PubChem CID | 20932816 |
| Molecular Formula | C28H28F2N2O3S |
| Molecular Weight | 510.61 g/mol |
| Exact Mass | 510.18 |
| IUPAC Name | 3-[1-(2,4-difluorophenyl)sulfonylpiperidin-4-yl]-1-[(3-methoxyphenyl)methyl]-2-methylindole |
| SMILES | COc1cccc(Cn2c(C)c(C3CCN(S(=O)(=O)c4ccc(F)cc4F)CC3)c3ccccc32)c1 |
| InChI | InChI=1S/C28H28F2N2O3S/c1-19-28(21-12-14-31(15-13-21)36(33,34)27-11-10-22(29)17-25(27)30)24-8-3-4-9-26(24)32(19)18-20-6-5-7-23(16-20)35-2/h3-11,16-17,21H,12-15,18H2,1-2H3 |
| InChIKey | ZBDWSEBZBMVECE-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.61 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|