C28H28F2N2O2S — CID 20932696
3-[1-(3,4-difluorophenyl)sulfonylpiperidin-4-yl]-2-methyl-1-[(2-methylphenyl)methyl]indole (PubChem CID 20932696) has the molecular formula C28H28F2N2O2S and a molecular weight of 494.61 g/mol. Its IUPAC name is 3-[1-(3,4-difluorophenyl)sulfonylpiperidin-4-yl]-2-methyl-1-[(2-methylphenyl)methyl]indole.
| Compound Name | 3-[1-(3,4-difluorophenyl)sulfonylpiperidin-4-yl]-2-methyl-1-[(2-methylphenyl)methyl]indole |
|---|---|
| PubChem CID | 20932696 |
| Molecular Formula | C28H28F2N2O2S |
| Molecular Weight | 494.61 g/mol |
| Exact Mass | 494.18 |
| IUPAC Name | 3-[1-(3,4-difluorophenyl)sulfonylpiperidin-4-yl]-2-methyl-1-[(2-methylphenyl)methyl]indole |
| SMILES | Cc1ccccc1Cn1c(C)c(C2CCN(S(=O)(=O)c3ccc(F)c(F)c3)CC2)c2ccccc21 |
| InChI | InChI=1S/C28H28F2N2O2S/c1-19-7-3-4-8-22(19)18-32-20(2)28(24-9-5-6-10-27(24)32)21-13-15-31(16-14-21)35(33,34)23-11-12-25(29)26(30)17-23/h3-12,17,21H,13-16,18H2,1-2H3 |
| InChIKey | CPYFPFQLRFQENT-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.61 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|