C26H28N2O2S2 — CID 20932675
2-methyl-1-[(2-methylphenyl)methyl]-3-(1-thiophen-2-ylsulfonylpiperidin-4-yl)indole (PubChem CID 20932675) has the molecular formula C26H28N2O2S2 and a molecular weight of 464.66 g/mol. Its IUPAC name is 2-methyl-1-[(2-methylphenyl)methyl]-3-(1-thiophen-2-ylsulfonylpiperidin-4-yl)indole.
| Compound Name | 2-methyl-1-[(2-methylphenyl)methyl]-3-(1-thiophen-2-ylsulfonylpiperidin-4-yl)indole |
|---|---|
| PubChem CID | 20932675 |
| Molecular Formula | C26H28N2O2S2 |
| Molecular Weight | 464.66 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | 2-methyl-1-[(2-methylphenyl)methyl]-3-(1-thiophen-2-ylsulfonylpiperidin-4-yl)indole |
| SMILES | Cc1ccccc1Cn1c(C)c(C2CCN(S(=O)(=O)c3cccs3)CC2)c2ccccc21 |
| InChI | InChI=1S/C26H28N2O2S2/c1-19-8-3-4-9-22(19)18-28-20(2)26(23-10-5-6-11-24(23)28)21-13-15-27(16-14-21)32(29,30)25-12-7-17-31-25/h3-12,17,21H,13-16,18H2,1-2H3 |
| InChIKey | XCHUOQISDALPDW-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.66 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|