C32H38N2O2S — CID 20932684
2-methyl-1-[(2-methylphenyl)methyl]-3-[1-[4-(2-methylpropyl)phenyl]sulfonylpiperidin-4-yl]indole (PubChem CID 20932684) has the molecular formula C32H38N2O2S and a molecular weight of 514.74 g/mol. Its IUPAC name is 2-methyl-1-[(2-methylphenyl)methyl]-3-[1-[4-(2-methylpropyl)phenyl]sulfonylpiperidin-4-yl]indole.
| Compound Name | 2-methyl-1-[(2-methylphenyl)methyl]-3-[1-[4-(2-methylpropyl)phenyl]sulfonylpiperidin-4-yl]indole |
|---|---|
| PubChem CID | 20932684 |
| Molecular Formula | C32H38N2O2S |
| Molecular Weight | 514.74 g/mol |
| Exact Mass | 514.27 |
| IUPAC Name | 2-methyl-1-[(2-methylphenyl)methyl]-3-[1-[4-(2-methylpropyl)phenyl]sulfonylpiperidin-4-yl]indole |
| SMILES | Cc1ccccc1Cn1c(C)c(C2CCN(S(=O)(=O)c3ccc(CC(C)C)cc3)CC2)c2ccccc21 |
| InChI | InChI=1S/C32H38N2O2S/c1-23(2)21-26-13-15-29(16-14-26)37(35,36)33-19-17-27(18-20-33)32-25(4)34(31-12-8-7-11-30(31)32)22-28-10-6-5-9-24(28)3/h5-16,23,27H,17-22H2,1-4H3 |
| InChIKey | DJSGBHXKFRYPDX-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.74 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|