C30H39N3O3S — CID 46256673
2-[3-[1-(4-tert-butylphenyl)sulfonylpiperidin-4-yl]-2-methylindol-1-yl]-1-pyrrolidin-1-ylethanone (PubChem CID 46256673) has the molecular formula C30H39N3O3S and a molecular weight of 521.73 g/mol. Its IUPAC name is 2-[3-[1-(4-tert-butylphenyl)sulfonylpiperidin-4-yl]-2-methylindol-1-yl]-1-pyrrolidin-1-ylethanone.
| Compound Name | 2-[3-[1-(4-tert-butylphenyl)sulfonylpiperidin-4-yl]-2-methylindol-1-yl]-1-pyrrolidin-1-ylethanone |
|---|---|
| PubChem CID | 46256673 |
| Molecular Formula | C30H39N3O3S |
| Molecular Weight | 521.73 g/mol |
| Exact Mass | 521.27 |
| IUPAC Name | 2-[3-[1-(4-tert-butylphenyl)sulfonylpiperidin-4-yl]-2-methylindol-1-yl]-1-pyrrolidin-1-ylethanone |
| SMILES | Cc1c(C2CCN(S(=O)(=O)c3ccc(C(C)(C)C)cc3)CC2)c2ccccc2n1CC(=O)N1CCCC1 |
| InChI | InChI=1S/C30H39N3O3S/c1-22-29(26-9-5-6-10-27(26)33(22)21-28(34)31-17-7-8-18-31)23-15-19-32(20-16-23)37(35,36)25-13-11-24(12-14-25)30(2,3)4/h5-6,9-14,23H,7-8,15-21H2,1-4H3 |
| InChIKey | HMHDQPWQHMEGKI-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 62.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.73 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|