C28H34ClN3O4S — CID 46256676
2-[3-[1-(5-chloro-2-ethoxyphenyl)sulfonylpiperidin-4-yl]-2-methylindol-1-yl]-1-pyrrolidin-1-ylethanone (PubChem CID 46256676) has the molecular formula C28H34ClN3O4S and a molecular weight of 544.12 g/mol. Its IUPAC name is 2-[3-[1-(5-chloro-2-ethoxyphenyl)sulfonylpiperidin-4-yl]-2-methylindol-1-yl]-1-pyrrolidin-1-ylethanone.
| Compound Name | 2-[3-[1-(5-chloro-2-ethoxyphenyl)sulfonylpiperidin-4-yl]-2-methylindol-1-yl]-1-pyrrolidin-1-ylethanone |
|---|---|
| PubChem CID | 46256676 |
| Molecular Formula | C28H34ClN3O4S |
| Molecular Weight | 544.12 g/mol |
| Exact Mass | 543.20 |
| IUPAC Name | 2-[3-[1-(5-chloro-2-ethoxyphenyl)sulfonylpiperidin-4-yl]-2-methylindol-1-yl]-1-pyrrolidin-1-ylethanone |
| SMILES | CCOc1ccc(Cl)cc1S(=O)(=O)N1CCC(c2c(C)n(CC(=O)N3CCCC3)c3ccccc23)CC1 |
| InChI | InChI=1S/C28H34ClN3O4S/c1-3-36-25-11-10-22(29)18-26(25)37(34,35)31-16-12-21(13-17-31)28-20(2)32(24-9-5-4-8-23(24)28)19-27(33)30-14-6-7-15-30/h4-5,8-11,18,21H,3,6-7,12-17,19H2,1-2H3 |
| InChIKey | IRDLFCPFOCWQAP-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 71.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.12 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|