C30H32ClFN2O2S — CID 46323086
1-[(2-chloro-6-fluorophenyl)methyl]-2-methyl-3-[1-(2,4,5-trimethylphenyl)sulfonylpiperidin-4-yl]indole (PubChem CID 46323086) has the molecular formula C30H32ClFN2O2S and a molecular weight of 539.12 g/mol. Its IUPAC name is 1-[(2-chloro-6-fluorophenyl)methyl]-2-methyl-3-[1-(2,4,5-trimethylphenyl)sulfonylpiperidin-4-yl]indole.
| Compound Name | 1-[(2-chloro-6-fluorophenyl)methyl]-2-methyl-3-[1-(2,4,5-trimethylphenyl)sulfonylpiperidin-4-yl]indole |
|---|---|
| PubChem CID | 46323086 |
| Molecular Formula | C30H32ClFN2O2S |
| Molecular Weight | 539.12 g/mol |
| Exact Mass | 538.19 |
| IUPAC Name | 1-[(2-chloro-6-fluorophenyl)methyl]-2-methyl-3-[1-(2,4,5-trimethylphenyl)sulfonylpiperidin-4-yl]indole |
| SMILES | Cc1cc(C)c(S(=O)(=O)N2CCC(c3c(C)n(Cc4c(F)cccc4Cl)c4ccccc34)CC2)cc1C |
| InChI | InChI=1S/C30H32ClFN2O2S/c1-19-16-21(3)29(17-20(19)2)37(35,36)33-14-12-23(13-15-33)30-22(4)34(28-11-6-5-8-24(28)30)18-25-26(31)9-7-10-27(25)32/h5-11,16-17,23H,12-15,18H2,1-4H3 |
| InChIKey | FVARVMFANSZYSH-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.12 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|