C30H27ClFN3O2S — CID 46323073
8-[4-[1-[(2-chloro-6-fluorophenyl)methyl]-2-methylindol-3-yl]piperidin-1-yl]sulfonylquinoline (PubChem CID 46323073) has the molecular formula C30H27ClFN3O2S and a molecular weight of 548.08 g/mol. Its IUPAC name is 8-[4-[1-[(2-chloro-6-fluorophenyl)methyl]-2-methylindol-3-yl]piperidin-1-yl]sulfonylquinoline.
| Compound Name | 8-[4-[1-[(2-chloro-6-fluorophenyl)methyl]-2-methylindol-3-yl]piperidin-1-yl]sulfonylquinoline |
|---|---|
| PubChem CID | 46323073 |
| Molecular Formula | C30H27ClFN3O2S |
| Molecular Weight | 548.08 g/mol |
| Exact Mass | 547.15 |
| IUPAC Name | 8-[4-[1-[(2-chloro-6-fluorophenyl)methyl]-2-methylindol-3-yl]piperidin-1-yl]sulfonylquinoline |
| SMILES | Cc1c(C2CCN(S(=O)(=O)c3cccc4cccnc34)CC2)c2ccccc2n1Cc1c(F)cccc1Cl |
| InChI | InChI=1S/C30H27ClFN3O2S/c1-20-29(23-9-2-3-12-27(23)35(20)19-24-25(31)10-5-11-26(24)32)21-14-17-34(18-15-21)38(36,37)28-13-4-7-22-8-6-16-33-30(22)28/h2-13,16,21H,14-15,17-19H2,1H3 |
| InChIKey | KXVOVXNZDRFGHI-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.08 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|