C26H27ClN2O3S2 — CID 20932797
3-[1-(5-chlorothiophen-2-yl)sulfonylpiperidin-4-yl]-1-[(3-methoxyphenyl)methyl]-2-methylindole (PubChem CID 20932797) has the molecular formula C26H27ClN2O3S2 and a molecular weight of 515.10 g/mol. Its IUPAC name is 3-[1-(5-chlorothiophen-2-yl)sulfonylpiperidin-4-yl]-1-[(3-methoxyphenyl)methyl]-2-methylindole.
| Compound Name | 3-[1-(5-chlorothiophen-2-yl)sulfonylpiperidin-4-yl]-1-[(3-methoxyphenyl)methyl]-2-methylindole |
|---|---|
| PubChem CID | 20932797 |
| Molecular Formula | C26H27ClN2O3S2 |
| Molecular Weight | 515.10 g/mol |
| Exact Mass | 514.12 |
| IUPAC Name | 3-[1-(5-chlorothiophen-2-yl)sulfonylpiperidin-4-yl]-1-[(3-methoxyphenyl)methyl]-2-methylindole |
| SMILES | COc1cccc(Cn2c(C)c(C3CCN(S(=O)(=O)c4ccc(Cl)s4)CC3)c3ccccc32)c1 |
| InChI | InChI=1S/C26H27ClN2O3S2/c1-18-26(20-12-14-28(15-13-20)34(30,31)25-11-10-24(27)33-25)22-8-3-4-9-23(22)29(18)17-19-6-5-7-21(16-19)32-2/h3-11,16,20H,12-15,17H2,1-2H3 |
| InChIKey | LGZJJPXYAGPHMW-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.10 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|