C28H34N4O3S — CID 50779316
1-[(3-methoxyphenyl)methyl]-2-methyl-3-[1-(1,3,5-trimethylpyrazol-4-yl)sulfonylpiperidin-4-yl]indole (PubChem CID 50779316) has the molecular formula C28H34N4O3S and a molecular weight of 506.67 g/mol. Its IUPAC name is 1-[(3-methoxyphenyl)methyl]-2-methyl-3-[1-(1,3,5-trimethylpyrazol-4-yl)sulfonylpiperidin-4-yl]indole.
| Compound Name | 1-[(3-methoxyphenyl)methyl]-2-methyl-3-[1-(1,3,5-trimethylpyrazol-4-yl)sulfonylpiperidin-4-yl]indole |
|---|---|
| PubChem CID | 50779316 |
| Molecular Formula | C28H34N4O3S |
| Molecular Weight | 506.67 g/mol |
| Exact Mass | 506.24 |
| IUPAC Name | 1-[(3-methoxyphenyl)methyl]-2-methyl-3-[1-(1,3,5-trimethylpyrazol-4-yl)sulfonylpiperidin-4-yl]indole |
| SMILES | COc1cccc(Cn2c(C)c(C3CCN(S(=O)(=O)c4c(C)nn(C)c4C)CC3)c3ccccc32)c1 |
| InChI | InChI=1S/C28H34N4O3S/c1-19-28(21(3)30(4)29-19)36(33,34)31-15-13-23(14-16-31)27-20(2)32(26-12-7-6-11-25(26)27)18-22-9-8-10-24(17-22)35-5/h6-12,17,23H,13-16,18H2,1-5H3 |
| InChIKey | INQVIUVOVOGGPW-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 69.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.67 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|