C27H27N3O4S — CID 16609883
10-[2-[4-(4-methylphenyl)sulfonyl-1,4-diazepan-1-yl]-2-oxoethyl]acridin-9-one (PubChem CID 16609883) has the molecular formula C27H27N3O4S and a molecular weight of 489.60 g/mol. Its IUPAC name is 10-[2-[4-(4-methylphenyl)sulfonyl-1,4-diazepan-1-yl]-2-oxoethyl]acridin-9-one.
| Compound Name | 10-[2-[4-(4-methylphenyl)sulfonyl-1,4-diazepan-1-yl]-2-oxoethyl]acridin-9-one |
|---|---|
| PubChem CID | 16609883 |
| Molecular Formula | C27H27N3O4S |
| Molecular Weight | 489.60 g/mol |
| Exact Mass | 489.17 |
| IUPAC Name | 10-[2-[4-(4-methylphenyl)sulfonyl-1,4-diazepan-1-yl]-2-oxoethyl]acridin-9-one |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCN(C(=O)Cn3c4ccccc4c(=O)c4ccccc43)CC2)cc1 |
| InChI | InChI=1S/C27H27N3O4S/c1-20-11-13-21(14-12-20)35(33,34)29-16-6-15-28(17-18-29)26(31)19-30-24-9-4-2-7-22(24)27(32)23-8-3-5-10-25(23)30/h2-5,7-14H,6,15-19H2,1H3 |
| InChIKey | ZQMXTVBFSUHHSV-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 79.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.60 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|