C32H39N3O3S — CID 46256658
1-(3,5-dimethylanilino)-3-[2-methyl-3-[1-(4-methylphenyl)sulfonylpiperidin-4-yl]indol-1-yl]propan-2-ol (PubChem CID 46256658) has the molecular formula C32H39N3O3S and a molecular weight of 545.75 g/mol. Its IUPAC name is 1-(3,5-dimethylanilino)-3-[2-methyl-3-[1-(4-methylphenyl)sulfonylpiperidin-4-yl]indol-1-yl]propan-2-ol.
| Compound Name | 1-(3,5-dimethylanilino)-3-[2-methyl-3-[1-(4-methylphenyl)sulfonylpiperidin-4-yl]indol-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 46256658 |
| Molecular Formula | C32H39N3O3S |
| Molecular Weight | 545.75 g/mol |
| Exact Mass | 545.27 |
| IUPAC Name | 1-(3,5-dimethylanilino)-3-[2-methyl-3-[1-(4-methylphenyl)sulfonylpiperidin-4-yl]indol-1-yl]propan-2-ol |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC(c3c(C)n(CC(O)CNc4cc(C)cc(C)c4)c4ccccc34)CC2)cc1 |
| InChI | InChI=1S/C32H39N3O3S/c1-22-9-11-29(12-10-22)39(37,38)34-15-13-26(14-16-34)32-25(4)35(31-8-6-5-7-30(31)32)21-28(36)20-33-27-18-23(2)17-24(3)19-27/h5-12,17-19,26,28,33,36H,13-16,20-21H2,1-4H3 |
| InChIKey | LLLYQMLWAPQZKZ-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 74.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.75 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|