C17H17NO5S — CID 56797616
2-[4-[(3-methyl-2,3-dihydroindol-1-yl)sulfonyl]phenoxy]acetic acid (PubChem CID 56797616) has the molecular formula C17H17NO5S and a molecular weight of 347.39 g/mol. Its IUPAC name is 2-[4-[(3-methyl-2,3-dihydroindol-1-yl)sulfonyl]phenoxy]acetic acid.
| Compound Name | 2-[4-[(3-methyl-2,3-dihydroindol-1-yl)sulfonyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 56797616 |
| Molecular Formula | C17H17NO5S |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | 2-[4-[(3-methyl-2,3-dihydroindol-1-yl)sulfonyl]phenoxy]acetic acid |
| SMILES | CC1CN(S(=O)(=O)c2ccc(OCC(=O)O)cc2)c2ccccc21 |
| InChI | InChI=1S/C17H17NO5S/c1-12-10-18(16-5-3-2-4-15(12)16)24(21,22)14-8-6-13(7-9-14)23-11-17(19)20/h2-9,12H,10-11H2,1H3,(H,19,20) |
| InChIKey | OVJUVCXVSQIGMW-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |