C16H17NO4S2 — CID 87026996
3-methyl-1-(2-methylsulfonylphenyl)sulfonyl-2,3-dihydroindole (PubChem CID 87026996) has the molecular formula C16H17NO4S2 and a molecular weight of 351.45 g/mol. Its IUPAC name is 3-methyl-1-(2-methylsulfonylphenyl)sulfonyl-2,3-dihydroindole.
| Compound Name | 3-methyl-1-(2-methylsulfonylphenyl)sulfonyl-2,3-dihydroindole |
|---|---|
| PubChem CID | 87026996 |
| Molecular Formula | C16H17NO4S2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.06 |
| IUPAC Name | 3-methyl-1-(2-methylsulfonylphenyl)sulfonyl-2,3-dihydroindole |
| SMILES | CC1CN(S(=O)(=O)c2ccccc2S(C)(=O)=O)c2ccccc21 |
| InChI | InChI=1S/C16H17NO4S2/c1-12-11-17(14-8-4-3-7-13(12)14)23(20,21)16-10-6-5-9-15(16)22(2,18)19/h3-10,12H,11H2,1-2H3 |
| InChIKey | ZUYWHFUIAZQYMQ-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |