C22H20N2O4S2 — CID 10717950
(2R)-1,4-bis(benzenesulfonyl)-2-ethenyl-2,3-dihydroquinoxaline (PubChem CID 10717950) has the molecular formula C22H20N2O4S2 and a molecular weight of 440.55 g/mol. Its IUPAC name is (2R)-1,4-bis(benzenesulfonyl)-2-ethenyl-2,3-dihydroquinoxaline.
| Compound Name | (2R)-1,4-bis(benzenesulfonyl)-2-ethenyl-2,3-dihydroquinoxaline |
|---|---|
| PubChem CID | 10717950 |
| Molecular Formula | C22H20N2O4S2 |
| Molecular Weight | 440.55 g/mol |
| Exact Mass | 440.09 |
| IUPAC Name | (2R)-1,4-bis(benzenesulfonyl)-2-ethenyl-2,3-dihydroquinoxaline |
| SMILES | C=C[C@@H]1CN(S(=O)(=O)c2ccccc2)c2ccccc2N1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C22H20N2O4S2/c1-2-18-17-23(29(25,26)19-11-5-3-6-12-19)21-15-9-10-16-22(21)24(18)30(27,28)20-13-7-4-8-14-20/h2-16,18H,1,17H2/t18-/m1/s1 |
| InChIKey | QJSBCMZNWFLSAO-GOSISDBHSA-N |
| XLogP | 3.65 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.55 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|