C30H39ClN2O4S2Si — CID 101388216
[1,4-bis(benzenesulfonyl)-7-chloro-2,3-dihydroquinoxalin-2-yl]methyl-tri(propan-2-yl)silane (PubChem CID 101388216) has the molecular formula C30H39ClN2O4S2Si and a molecular weight of 619.33 g/mol. Its IUPAC name is [1,4-bis(benzenesulfonyl)-7-chloro-2,3-dihydroquinoxalin-2-yl]methyl-tri(propan-2-yl)silane.
| Compound Name | [1,4-bis(benzenesulfonyl)-7-chloro-2,3-dihydroquinoxalin-2-yl]methyl-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 101388216 |
| Molecular Formula | C30H39ClN2O4S2Si |
| Molecular Weight | 619.33 g/mol |
| Exact Mass | 618.18 |
| IUPAC Name | [1,4-bis(benzenesulfonyl)-7-chloro-2,3-dihydroquinoxalin-2-yl]methyl-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](CC1CN(S(=O)(=O)c2ccccc2)c2ccc(Cl)cc2N1S(=O)(=O)c1ccccc1)(C(C)C)C(C)C |
| InChI | InChI=1S/C30H39ClN2O4S2Si/c1-22(2)40(23(3)4,24(5)6)21-26-20-32(38(34,35)27-13-9-7-10-14-27)29-18-17-25(31)19-30(29)33(26)39(36,37)28-15-11-8-12-16-28/h7-19,22-24,26H,20-21H2,1-6H3 |
| InChIKey | BUVMSVLKSRYUCK-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.33 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|