C25H37NO3SSi — CID 73228744
[3-(benzenesulfonyl)-2-phenyl-1,3-oxazolidin-4-yl]methyl-tri(propan-2-yl)silane (PubChem CID 73228744) has the molecular formula C25H37NO3SSi and a molecular weight of 459.73 g/mol. Its IUPAC name is [3-(benzenesulfonyl)-2-phenyl-1,3-oxazolidin-4-yl]methyl-tri(propan-2-yl)silane.
| Compound Name | [3-(benzenesulfonyl)-2-phenyl-1,3-oxazolidin-4-yl]methyl-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 73228744 |
| Molecular Formula | C25H37NO3SSi |
| Molecular Weight | 459.73 g/mol |
| Exact Mass | 459.23 |
| IUPAC Name | [3-(benzenesulfonyl)-2-phenyl-1,3-oxazolidin-4-yl]methyl-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](CC1COC(c2ccccc2)N1S(=O)(=O)c1ccccc1)(C(C)C)C(C)C |
| InChI | InChI=1S/C25H37NO3SSi/c1-19(2)31(20(3)4,21(5)6)18-23-17-29-25(22-13-9-7-10-14-22)26(23)30(27,28)24-15-11-8-12-16-24/h7-16,19-21,23,25H,17-18H2,1-6H3 |
| InChIKey | RBBYWHJAMQEARV-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.73 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|