C11H12N2O3S — CID 71422035
1-(benzenesulfonyl)-4-ethenylimidazolidin-2-one (PubChem CID 71422035) has the molecular formula C11H12N2O3S and a molecular weight of 252.30 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-4-ethenylimidazolidin-2-one.
| Compound Name | 1-(benzenesulfonyl)-4-ethenylimidazolidin-2-one |
|---|---|
| PubChem CID | 71422035 |
| Molecular Formula | C11H12N2O3S |
| Molecular Weight | 252.30 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | 1-(benzenesulfonyl)-4-ethenylimidazolidin-2-one |
| SMILES | C=CC1CN(S(=O)(=O)c2ccccc2)C(=O)N1 |
| InChI | InChI=1S/C11H12N2O3S/c1-2-9-8-13(11(14)12-9)17(15,16)10-6-4-3-5-7-10/h2-7,9H,1,8H2,(H,12,14) |
| InChIKey | MRYHOKMYOGCADZ-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.30 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|