C15H16FN5O3 — CID 86591695
(5S)-5-(azidomethyl)-3-[4-(3-fluoro-4-oxopiperidin-1-yl)phenyl]-1,3-oxazolidin-2-one (PubChem CID 86591695) has the molecular formula C15H16FN5O3 and a molecular weight of 333.32 g/mol. Its IUPAC name is (5S)-5-(azidomethyl)-3-[4-(3-fluoro-4-oxopiperidin-1-yl)phenyl]-1,3-oxazolidin-2-one.
| Compound Name | (5S)-5-(azidomethyl)-3-[4-(3-fluoro-4-oxopiperidin-1-yl)phenyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 86591695 |
| Molecular Formula | C15H16FN5O3 |
| Molecular Weight | 333.32 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | (5S)-5-(azidomethyl)-3-[4-(3-fluoro-4-oxopiperidin-1-yl)phenyl]-1,3-oxazolidin-2-one |
| SMILES | [N-]=[N+]=NC[C@@H]1CN(c2ccc(N3CCC(=O)C(F)C3)cc2)C(=O)O1 |
| InChI | InChI=1S/C15H16FN5O3/c16-13-9-20(6-5-14(13)22)10-1-3-11(4-2-10)21-8-12(7-18-19-17)24-15(21)23/h1-4,12-13H,5-9H2/t12-,13?/m1/s1 |
| InChIKey | MULGNESHHYXLPU-PZORYLMUSA-N |
| XLogP | 2.44 |
| TPSA | 98.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.32 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|