C13H16N4O2 — CID 14011248
5-(azidomethyl)-3-(4-propan-2-ylphenyl)-1,3-oxazolidin-2-one (PubChem CID 14011248) has the molecular formula C13H16N4O2 and a molecular weight of 260.30 g/mol. Its IUPAC name is 5-(azidomethyl)-3-(4-propan-2-ylphenyl)-1,3-oxazolidin-2-one.
| Compound Name | 5-(azidomethyl)-3-(4-propan-2-ylphenyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 14011248 |
| Molecular Formula | C13H16N4O2 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 5-(azidomethyl)-3-(4-propan-2-ylphenyl)-1,3-oxazolidin-2-one |
| SMILES | CC(C)c1ccc(N2CC(CN=[N+]=[N-])OC2=O)cc1 |
| InChI | InChI=1S/C13H16N4O2/c1-9(2)10-3-5-11(6-4-10)17-8-12(7-15-16-14)19-13(17)18/h3-6,9,12H,7-8H2,1-2H3 |
| InChIKey | BEQDBKQJGWFXQD-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 78.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|